C32H49N7O5S — CID 163593825
(2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-4-oxo-2-(thiophen-3-ylmethyl)nonanamide (PubChem CID 163593825) has the molecular formula C32H49N7O5S and a molecular weight of 643.86 g/mol. Its IUPAC name is (2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-4-oxo-2-(thiophen-3-ylmethyl)nonanamide.
| Compound Name | (2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-4-oxo-2-(thiophen-3-ylmethyl)nonanamide |
|---|---|
| PubChem CID | 163593825 |
| Molecular Formula | C32H49N7O5S |
| Molecular Weight | 643.86 g/mol |
| Exact Mass | 643.35 |
| IUPAC Name | (2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-4-oxo-2-(thiophen-3-ylmethyl)nonanamide |
| SMILES | Cc1cc(O)cc(C)c1C[C@H](CC(=O)[C@H](N)CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)C[C@@H](Cc1ccsc1)C(N)=O |
| InChI | InChI=1S/C32H49N7O5S/c1-19-12-24(40)13-20(2)25(19)15-23(17-28(41)26(34)6-5-10-38-32(36)37)31(44)39-27(7-3-4-9-33)29(42)16-22(30(35)43)14-21-8-11-45-18-21/h8,11-13,18,22-23,26-27,40H,3-7,9-10,14-17,33-34H2,1-2H3,(H2,35,43)(H,39,44)(H4,36,37,38)/t22-,23-,26-,27+/m1/s1 |
| InChIKey | GRTCNWMCVUAWPM-CIMSBJEKSA-N |
| XLogP | 1.49 |
| TPSA | 243.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.86 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|