C34H51N7O5 — CID 159151673
(2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-2-benzyl-2-deuterio-4-oxononanamide (PubChem CID 159151673) has the molecular formula C34H51N7O5 and a molecular weight of 638.83 g/mol. Its IUPAC name is (2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-2-benzyl-2-deuterio-4-oxononanamide.
| Compound Name | (2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-2-benzyl-2-deuterio-4-oxononanamide |
|---|---|
| PubChem CID | 159151673 |
| Molecular Formula | C34H51N7O5 |
| Molecular Weight | 638.83 g/mol |
| Exact Mass | 638.40 |
| IUPAC Name | (2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-2-benzyl-2-deuterio-4-oxononanamide |
| SMILES | [2H][C@](CC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)[C@H](N)CCCN=C(N)N)Cc1c(C)cc(O)cc1C)(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C34H51N7O5/c1-21-15-26(42)16-22(2)27(21)18-25(20-30(43)28(36)11-8-14-40-34(38)39)33(46)41-29(12-6-7-13-35)31(44)19-24(32(37)45)17-23-9-4-3-5-10-23/h3-5,9-10,15-16,24-25,28-29,42H,6-8,11-14,17-20,35-36H2,1-2H3,(H2,37,45)(H,41,46)(H4,38,39,40)/t24-,25-,28-,29+/m1/s1/i24D |
| InChIKey | QQOYKUSYHZNRNP-XCEQOOLGSA-N |
| XLogP | 1.43 |
| TPSA | 243.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.83 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|