C76H109BN14O12 — CID 161103044
CID 161103044 (PubChem CID 161103044) has the molecular formula C76H109BN14O12 and a molecular weight of 1429.65 g/mol.
| Compound Name | CID 161103044 |
|---|---|
| PubChem CID | 161103044 |
| Molecular Formula | C76H109BN14O12 |
| Molecular Weight | 1429.65 g/mol |
| Exact Mass | 1428.89 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(N)CCC[C@]([2H])(NC(=O)[C@@H](CC(=O)[C@@H](CCCN=C(N)N)NC(=O)OCc1ccccc1)Cc1c(C)cc(O)cc1C)C(=O)C[C@@H](Cc1ccccc1)C(N)=O.[2H]C([2H])(N)CCC[C@]([2H])(NC(=O)[C@@H](CC(=O)[C@H](N)CCCN=C(N)N)Cc1c(C)cc(O)cc1C)C(=O)CC(Cc1ccccc1)C(N)=O.[3H][B] |
| InChI | InChI=1S/C42H57N7O7.C34H51N7O5.BH/c1-27-20-33(50)21-28(2)34(27)23-32(25-38(52)36(17-11-19-47-41(45)46)49-42(55)56-26-30-14-7-4-8-15-30)40(54)48-35(16-9-10-18-43)37(51)24-31(39(44)53)22-29-12-5-3-6-13-29;1-21-15-26(42)16-22(2)27(21)18-25(20-30(43)28(36)11-8-14-40-34(38)39)33(46)41-29(12-6-7-13-35)31(44)19-24(32(37)45)17-23-9-4-3-5-10-23;/h3-8,12-15,20-21,31-32,35-36,50H,9-11,16-19,22-26,43H2,1-2H3,(H2,44,53)(H,48,54)(H,49,55)(H4,45,46,47);3-5,9-10,15-16,24-25,28-29,42H,6-8,11-14,17-20,35-36H2,1-2H3,(H2,37,45)(H,41,46)(H4,38,39,40);1H/t31-,32-,35+,36-;24?,25-,28-,29+;/m11./s1/i18D2,35D;13D2,29D;1T |
| InChIKey | POMXNWGEBWVKKL-FOQDAWGMSA-N |
| XLogP | 4.17 |
| TPSA | 498.31 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 103 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1429.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|