C26H31N3O10 — CID 10209266
(2R)-2-[[2-[carboxymethyl-(3-hydroxy-4-methoxybenzoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 10209266) has the molecular formula C26H31N3O10 and a molecular weight of 545.55 g/mol. Its IUPAC name is (2R)-2-[[2-[carboxymethyl-(3-hydroxy-4-methoxybenzoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2R)-2-[[2-[carboxymethyl-(3-hydroxy-4-methoxybenzoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 10209266 |
| Molecular Formula | C26H31N3O10 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (2R)-2-[[2-[carboxymethyl-(3-hydroxy-4-methoxybenzoyl)amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | COc1ccc(C(=O)N(CC(=O)O)CC(=O)N[C@H](CCCCNC(=O)OCc2ccccc2)C(=O)O)cc1O |
| InChI | InChI=1S/C26H31N3O10/c1-38-21-11-10-18(13-20(21)30)24(34)29(15-23(32)33)14-22(31)28-19(25(35)36)9-5-6-12-27-26(37)39-16-17-7-3-2-4-8-17/h2-4,7-8,10-11,13,19,30H,5-6,9,12,14-16H2,1H3,(H,27,37)(H,28,31)(H,32,33)(H,35,36)/t19-/m1/s1 |
| InChIKey | HUKJLOQRFRECLV-LJQANCHMSA-N |
| XLogP | 1.59 |
| TPSA | 191.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|