C22H31N3O2 — CID 23625663
benzyl N-[6-[ethyl(pyridin-4-ylmethyl)amino]hexyl]carbamate (PubChem CID 23625663) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is benzyl N-[6-[ethyl(pyridin-4-ylmethyl)amino]hexyl]carbamate.
| Compound Name | benzyl N-[6-[ethyl(pyridin-4-ylmethyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 23625663 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | benzyl N-[6-[ethyl(pyridin-4-ylmethyl)amino]hexyl]carbamate |
| SMILES | CCN(CCCCCCNC(=O)OCc1ccccc1)Cc1ccncc1 |
| InChI | InChI=1S/C22H31N3O2/c1-2-25(18-20-12-15-23-16-13-20)17-9-4-3-8-14-24-22(26)27-19-21-10-6-5-7-11-21/h5-7,10-13,15-16H,2-4,8-9,14,17-19H2,1H3,(H,24,26) |
| InChIKey | PTIKLWZABUVQGJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|