C29H35N3O4 — CID 10696527
benzyl N-[4-[benzyl-[3-(phenoxycarbonyl(15N)amino)propyl](15N)amino](1,4-13C2)butyl]carbamate (PubChem CID 10696527) has the molecular formula C29H35N3O4 and a molecular weight of 494.58 g/mol. Its IUPAC name is benzyl N-[4-[benzyl-[3-(phenoxycarbonyl(15N)amino)propyl](15N)amino](1,4-13C2)butyl]carbamate.
| Compound Name | benzyl N-[4-[benzyl-[3-(phenoxycarbonyl(15N)amino)propyl](15N)amino](1,4-13C2)butyl]carbamate |
|---|---|
| PubChem CID | 10696527 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | benzyl N-[4-[benzyl-[3-(phenoxycarbonyl(15N)amino)propyl](15N)amino](1,4-13C2)butyl]carbamate |
| SMILES | O=C([15NH][13CH2]CC[13CH2][15N](CCC[15NH]C(=O)Oc1ccccc1)Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C29H35N3O4/c33-28(35-24-26-15-6-2-7-16-26)30-19-10-11-21-32(23-25-13-4-1-5-14-25)22-12-20-31-29(34)36-27-17-8-3-9-18-27/h1-9,13-18H,10-12,19-24H2,(H,30,33)(H,31,34)/i19+1,21+1,30+1,31+1,32+1 |
| InChIKey | NECCPPHXLTWEOV-MTHUWOCNSA-N |
| XLogP | 5.37 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|