C35H50N4O8 — CID 70054448
methyl 2-[[3-(hydroxymethyl)-2-(7-phenylheptanoylamino)-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoyl]amino]-3-methylbutanoate (PubChem CID 70054448) has the molecular formula C35H50N4O8 and a molecular weight of 654.81 g/mol. Its IUPAC name is methyl 2-[[3-(hydroxymethyl)-2-(7-phenylheptanoylamino)-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[3-(hydroxymethyl)-2-(7-phenylheptanoylamino)-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 70054448 |
| Molecular Formula | C35H50N4O8 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.36 |
| IUPAC Name | methyl 2-[[3-(hydroxymethyl)-2-(7-phenylheptanoylamino)-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)C(NC(=O)CCCCCCc1ccccc1)C(CO)CNC(=O)[C@H](C)NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C35H50N4O8/c1-24(2)30(34(44)46-4)39-33(43)31(38-29(41)20-14-6-5-9-15-26-16-10-7-11-17-26)28(22-40)21-36-32(42)25(3)37-35(45)47-23-27-18-12-8-13-19-27/h7-8,10-13,16-19,24-25,28,30-31,40H,5-6,9,14-15,20-23H2,1-4H3,(H,36,42)(H,37,45)(H,38,41)(H,39,43)/t25-,28?,30?,31?/m0/s1 |
| InChIKey | PCRAQQQWISEAJD-DDBRYOJQSA-N |
| XLogP | 3.02 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|