C41H54N4O8 — CID 70056230
methyl 2-[[(2R)-2-(hexanoylamino)-3-(hydroxymethyl)-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-2-[(2-phenylphenyl)methyl]butanoyl]amino]-3-methylbutanoate (PubChem CID 70056230) has the molecular formula C41H54N4O8 and a molecular weight of 730.90 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-(hexanoylamino)-3-(hydroxymethyl)-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-2-[(2-phenylphenyl)methyl]butanoyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[(2R)-2-(hexanoylamino)-3-(hydroxymethyl)-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-2-[(2-phenylphenyl)methyl]butanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 70056230 |
| Molecular Formula | C41H54N4O8 |
| Molecular Weight | 730.90 g/mol |
| Exact Mass | 730.39 |
| IUPAC Name | methyl 2-[[(2R)-2-(hexanoylamino)-3-(hydroxymethyl)-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-2-[(2-phenylphenyl)methyl]butanoyl]amino]-3-methylbutanoate |
| SMILES | CCCCCC(=O)N[C@@](Cc1ccccc1-c1ccccc1)(C(=O)NC(C(=O)OC)C(C)C)C(CO)CNC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H54N4O8/c1-6-7-10-23-35(47)45-41(39(50)44-36(28(2)3)38(49)52-5,24-32-21-15-16-22-34(32)31-19-13-9-14-20-31)33(26-46)25-42-37(48)29(4)43-40(51)53-27-30-17-11-8-12-18-30/h8-9,11-22,28-29,33,36,46H,6-7,10,23-27H2,1-5H3,(H,42,48)(H,43,51)(H,44,50)(H,45,47)/t29-,33?,36?,41+/m0/s1 |
| InChIKey | WWHLHXCMWUTLOW-WBTQBRGVSA-N |
| XLogP | 4.68 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.90 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|