C28H44N2O3 — CID 11539801
(Z)-18-cyano-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]octadec-9-enamide (PubChem CID 11539801) has the molecular formula C28H44N2O3 and a molecular weight of 456.67 g/mol. Its IUPAC name is (Z)-18-cyano-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]octadec-9-enamide.
| Compound Name | (Z)-18-cyano-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 11539801 |
| Molecular Formula | C28H44N2O3 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | (Z)-18-cyano-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]octadec-9-enamide |
| SMILES | N#CCCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](CO)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C28H44N2O3/c29-22-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-28(33)30-26(24-31)23-25-18-20-27(32)21-19-25/h1,3,18-21,26,31-32H,2,4-17,23-24H2,(H,30,33)/b3-1-/t26-/m0/s1 |
| InChIKey | WUVHMRKCAIEXMB-CBEQZNMTSA-N |
| XLogP | 6.34 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|