C19H27N3O7 — CID 130333043
methyl 6-[[(2S)-1-[3,5-bis(hydroxymethyl)anilino]-1-oxopropan-2-yl]carbamoylamino]-6-oxohexanoate (PubChem CID 130333043) has the molecular formula C19H27N3O7 and a molecular weight of 409.44 g/mol. Its IUPAC name is methyl 6-[[(2S)-1-[3,5-bis(hydroxymethyl)anilino]-1-oxopropan-2-yl]carbamoylamino]-6-oxohexanoate.
| Compound Name | methyl 6-[[(2S)-1-[3,5-bis(hydroxymethyl)anilino]-1-oxopropan-2-yl]carbamoylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 130333043 |
| Molecular Formula | C19H27N3O7 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | methyl 6-[[(2S)-1-[3,5-bis(hydroxymethyl)anilino]-1-oxopropan-2-yl]carbamoylamino]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)NC(=O)N[C@@H](C)C(=O)Nc1cc(CO)cc(CO)c1 |
| InChI | InChI=1S/C19H27N3O7/c1-12(18(27)21-15-8-13(10-23)7-14(9-15)11-24)20-19(28)22-16(25)5-3-4-6-17(26)29-2/h7-9,12,23-24H,3-6,10-11H2,1-2H3,(H,21,27)(H2,20,22,25,28)/t12-/m0/s1 |
| InChIKey | OJOCOTJZFQUKNO-LBPRGKRZSA-N |
| XLogP | 0.56 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|