C40H72N2O11 — CID 161037807
tert-butyl (2R,5S)-5-amino-2,6-dimethyl-4-oxoheptanoate;tert-butyl (2R,5S)-2,6-dimethyl-4-oxo-5-(6-oxoheptanoylamino)heptanoate;6-oxoheptanoic acid (PubChem CID 161037807) has the molecular formula C40H72N2O11 and a molecular weight of 757.02 g/mol. Its IUPAC name is tert-butyl (2R,5S)-5-amino-2,6-dimethyl-4-oxoheptanoate;tert-butyl (2R,5S)-2,6-dimethyl-4-oxo-5-(6-oxoheptanoylamino)heptanoate;6-oxoheptanoic acid.
| Compound Name | tert-butyl (2R,5S)-5-amino-2,6-dimethyl-4-oxoheptanoate;tert-butyl (2R,5S)-2,6-dimethyl-4-oxo-5-(6-oxoheptanoylamino)heptanoate;6-oxoheptanoic acid |
|---|---|
| PubChem CID | 161037807 |
| Molecular Formula | C40H72N2O11 |
| Molecular Weight | 757.02 g/mol |
| Exact Mass | 756.51 |
| IUPAC Name | tert-butyl (2R,5S)-5-amino-2,6-dimethyl-4-oxoheptanoate;tert-butyl (2R,5S)-2,6-dimethyl-4-oxo-5-(6-oxoheptanoylamino)heptanoate;6-oxoheptanoic acid |
| SMILES | CC(=O)CCCCC(=O)N[C@H](C(=O)C[C@@H](C)C(=O)OC(C)(C)C)C(C)C.CC(=O)CCCCC(=O)O.CC(C)[C@H](N)C(=O)C[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H35NO5.C13H25NO3.C7H12O3/c1-13(2)18(21-17(24)11-9-8-10-15(4)22)16(23)12-14(3)19(25)26-20(5,6)7;1-8(2)11(14)10(15)7-9(3)12(16)17-13(4,5)6;1-6(8)4-2-3-5-7(9)10/h13-14,18H,8-12H2,1-7H3,(H,21,24);8-9,11H,7,14H2,1-6H3;2-5H2,1H3,(H,9,10)/t14-,18+;9-,11+;/m11./s1 |
| InChIKey | UAMFEVHWGSKPFY-OSKSVUMOSA-N |
| XLogP | 6.34 |
| TPSA | 213.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.02 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|