C20H36N2O6 — CID 142118833
3-methyl-2-[[(2S)-3-methyl-2-[[6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoyl]amino]butanoyl]amino]butanoic acid (PubChem CID 142118833) has the molecular formula C20H36N2O6 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-methyl-2-[[(2S)-3-methyl-2-[[6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoyl]amino]butanoyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[(2S)-3-methyl-2-[[6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoyl]amino]butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 142118833 |
| Molecular Formula | C20H36N2O6 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 3-methyl-2-[[(2S)-3-methyl-2-[[6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoyl]amino]butanoyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)[C@@H](NC(=O)CCCCC(=O)OC(C)(C)C)C(C)C)C(=O)O |
| InChI | InChI=1S/C20H36N2O6/c1-12(2)16(18(25)22-17(13(3)4)19(26)27)21-14(23)10-8-9-11-15(24)28-20(5,6)7/h12-13,16-17H,8-11H2,1-7H3,(H,21,23)(H,22,25)(H,26,27)/t16-,17?/m0/s1 |
| InChIKey | ZWNWFWQETUSKQY-BHWOMJMDSA-N |
| XLogP | 2.25 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|