C23H46N3O5- — CID 131714867
(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoic acid;[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]azanide (PubChem CID 131714867) has the molecular formula C23H46N3O5- and a molecular weight of 444.64 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoic acid;[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]azanide.
| Compound Name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoic acid;[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]azanide |
|---|---|
| PubChem CID | 131714867 |
| Molecular Formula | C23H46N3O5- |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-methylbutanoic acid;[8-[(2-methylpropan-2-yl)oxy]-8-oxooctyl]azanide |
| SMILES | CC(C)(C)OC(=O)CCCCCCC[NH-].CC(C)C[C@H](N)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C12H24NO2.C11H22N2O3/c1-12(2,3)15-11(14)9-7-5-4-6-8-10-13;1-6(2)5-8(12)10(14)13-9(7(3)4)11(15)16/h13H,4-10H2,1-3H3;6-9H,5,12H2,1-4H3,(H,13,14)(H,15,16)/q-1;/t;8-,9-/m.0/s1 |
| InChIKey | GEDIESNGQDXJKF-LGIJPLARSA-N |
| XLogP | 4.31 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|