C21H38N2O4 — CID 15408434
(2S)-3-methyl-2-[[(2S)-3-methyl-2-(undec-10-enoylamino)butanoyl]amino]butanoic acid (PubChem CID 15408434) has the molecular formula C21H38N2O4 and a molecular weight of 382.55 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2S)-3-methyl-2-(undec-10-enoylamino)butanoyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2S)-3-methyl-2-(undec-10-enoylamino)butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 15408434 |
| Molecular Formula | C21H38N2O4 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | (2S)-3-methyl-2-[[(2S)-3-methyl-2-(undec-10-enoylamino)butanoyl]amino]butanoic acid |
| SMILES | C=CCCCCCCCCC(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C21H38N2O4/c1-6-7-8-9-10-11-12-13-14-17(24)22-18(15(2)3)20(25)23-19(16(4)5)21(26)27/h6,15-16,18-19H,1,7-14H2,2-5H3,(H,22,24)(H,23,25)(H,26,27)/t18-,19-/m0/s1 |
| InChIKey | ZUWSABPBEHYBCX-OALUTQOASA-N |
| XLogP | 3.66 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|