C14H13N2O5- — CID 6920360
(2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate (PubChem CID 6920360) has the molecular formula C14H13N2O5- and a molecular weight of 289.27 g/mol. Its IUPAC name is (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate.
| Compound Name | (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate |
|---|---|
| PubChem CID | 6920360 |
| Molecular Formula | C14H13N2O5- |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate |
| SMILES | COc1cc(OC)nc(O[C@H](C(=O)[O-])c2ccccc2)n1 |
| InChI | InChI=1S/C14H14N2O5/c1-19-10-8-11(20-2)16-14(15-10)21-12(13(17)18)9-6-4-3-5-7-9/h3-8,12H,1-2H3,(H,17,18)/p-1/t12-/m0/s1 |
| InChIKey | IDLITGCUZZUBBZ-LBPRGKRZSA-M |
| XLogP | 0.36 |
| TPSA | 93.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |