About (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate
(2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate (PubChem CID 6920360) has the molecular formula C14H13N2O5-
and a molecular weight of 289.27 g/mol. Its IUPAC name is (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate.
Molecular Properties
| Compound Name | (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate |
| PubChem CID | 6920360 |
| Molecular Formula | C14H13N2O5- |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate |
| SMILES | COc1cc(OC)nc(O[C@H](C(=O)[O-])c2ccccc2)n1 |
| InChI | InChI=1S/C14H14N2O5/c1-19-10-8-11(20-2)16-14(15-10)21-12(13(17)18)9-6-4-3-5-7-9/h3-8,12H,1-2H3,(H,17,18)/p-1/t12-/m0/s1 |
| InChIKey | IDLITGCUZZUBBZ-LBPRGKRZSA-M |
| XLogP | 0.36 |
| TPSA | 93.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate?
The IUPAC name of (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate (CID 6920360) is (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate.
What is the SMILES notation for (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate?
The canonical SMILES for (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate is COc1cc(OC)nc(O[C@H](C(=O)[O-])c2ccccc2)n1.
What is the InChIKey of (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate?
The InChIKey is IDLITGCUZZUBBZ-LBPRGKRZSA-M. The full InChI is InChI=1S/C14H14N2O5/c1-19-10-8-11(20-2)16-14(15-10)21-12(13(17)18)9-6-4-3-5-7-9/h3-8,12H,1-2H3,(H,17,18)/p-1/t12-/m0/s1.
What are the key properties of (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate?
(2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate has a molecular weight of 289.27 g/mol, XLogP of 0.36, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenylacetate is sourced from PubChem (CID 6920360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).