C10H15N3O4 — CID 115354713
2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpropanoic acid (PubChem CID 115354713) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 115354713 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpropanoic acid |
| SMILES | COc1cc(OC)nc(NC(C)(C)C(=O)O)n1 |
| InChI | InChI=1S/C10H15N3O4/c1-10(2,8(14)15)13-9-11-6(16-3)5-7(12-9)17-4/h5H,1-4H3,(H,14,15)(H,11,12,13) |
| InChIKey | BLBXTXVQMKDMCN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |