C16H18Cl2N6O3 — CID 22534185
4-N-(2,4-dichlorophenyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22534185) has the molecular formula C16H18Cl2N6O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is 4-N-(2,4-dichlorophenyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,4-dichlorophenyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22534185 |
| Molecular Formula | C16H18Cl2N6O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 4-N-(2,4-dichlorophenyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCCN2CCOCC2)ncnc1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N6O3/c17-11-1-2-13(12(18)9-11)22-16-14(24(25)26)15(20-10-21-16)19-3-4-23-5-7-27-8-6-23/h1-2,9-10H,3-8H2,(H2,19,20,21,22) |
| InChIKey | DDKORBDFVJYVAK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|