C24H18BrFN6O3 — CID 22536976
N'-[6-(4-bromo-2-fluoroanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 22536976) has the molecular formula C24H18BrFN6O3 and a molecular weight of 537.35 g/mol. Its IUPAC name is N'-[6-(4-bromo-2-fluoroanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[6-(4-bromo-2-fluoroanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 22536976 |
| Molecular Formula | C24H18BrFN6O3 |
| Molecular Weight | 537.35 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | N'-[6-(4-bromo-2-fluoroanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccc(Br)cc2F)c1[N+](=O)[O-])C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H18BrFN6O3/c25-17-11-12-19(18(26)13-17)29-22-21(32(34)35)23(28-14-27-22)30-31-24(33)20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,20H,(H,31,33)(H2,27,28,29,30) |
| InChIKey | IKAZLKJTADCKIY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.35 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|