C24H19FN6O3 — CID 22533315
N'-[6-(4-fluoroanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 22533315) has the molecular formula C24H19FN6O3 and a molecular weight of 458.45 g/mol. Its IUPAC name is N'-[6-(4-fluoroanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[6-(4-fluoroanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 22533315 |
| Molecular Formula | C24H19FN6O3 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N'-[6-(4-fluoroanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccc(F)cc2)c1[N+](=O)[O-])C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19FN6O3/c25-18-11-13-19(14-12-18)28-22-21(31(33)34)23(27-15-26-22)29-30-24(32)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,20H,(H,30,32)(H2,26,27,28,29) |
| InChIKey | KARDEHPFJIFWJW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|