C15H12ClN7O4 — CID 23479018
3-chloro-N'-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23479018) has the molecular formula C15H12ClN7O4 and a molecular weight of 389.76 g/mol. Its IUPAC name is 3-chloro-N'-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 3-chloro-N'-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23479018 |
| Molecular Formula | C15H12ClN7O4 |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 3-chloro-N'-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | Cc1cc(Nc2ncnc(NNC(=O)c3cccc(Cl)c3)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C15H12ClN7O4/c1-8-5-11(22-27-8)19-13-12(23(25)26)14(18-7-17-13)20-21-15(24)9-3-2-4-10(16)6-9/h2-7H,1H3,(H,21,24)(H2,17,18,19,20,22) |
| InChIKey | WYPWIRISYGWRGV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|