C20H22N6O5S — CID 23494339
ethyl 1-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 23494339) has the molecular formula C20H22N6O5S and a molecular weight of 458.50 g/mol. Its IUPAC name is ethyl 1-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23494339 |
| Molecular Formula | C20H22N6O5S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | ethyl 1-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Nc3nc4ccc(OC)cc4s3)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H22N6O5S/c1-3-31-19(27)12-5-4-8-25(10-12)18-16(26(28)29)17(21-11-22-18)24-20-23-14-7-6-13(30-2)9-15(14)32-20/h6-7,9,11-12H,3-5,8,10H2,1-2H3,(H,21,22,23,24) |
| InChIKey | HNFAANMRDIJPFQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|