C25H19N5OS — CID 154873076
N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-(quinazolin-4-ylamino)benzamide (PubChem CID 154873076) has the molecular formula C25H19N5OS and a molecular weight of 437.53 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-(quinazolin-4-ylamino)benzamide.
| Compound Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-(quinazolin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 154873076 |
| Molecular Formula | C25H19N5OS |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-3-(quinazolin-4-ylamino)benzamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)c3cccc(Nc4ncnc5ccccc45)c3)cc2)cs1 |
| InChI | InChI=1S/C25H19N5OS/c1-16-28-23(14-32-16)17-9-11-19(12-10-17)30-25(31)18-5-4-6-20(13-18)29-24-21-7-2-3-8-22(21)26-15-27-24/h2-15H,1H3,(H,30,31)(H,26,27,29) |
| InChIKey | SPODDTVUKJZOQY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |