C19H15N5O3 — CID 119040707
2-(1,3-dioxoisoindol-2-yl)-N'-quinazolin-4-ylpropanehydrazide (PubChem CID 119040707) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N'-quinazolin-4-ylpropanehydrazide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N'-quinazolin-4-ylpropanehydrazide |
|---|---|
| PubChem CID | 119040707 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N'-quinazolin-4-ylpropanehydrazide |
| SMILES | CC(C(=O)NNc1ncnc2ccccc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15N5O3/c1-11(24-18(26)12-6-2-3-7-13(12)19(24)27)17(25)23-22-16-14-8-4-5-9-15(14)20-10-21-16/h2-11H,1H3,(H,23,25)(H,20,21,22) |
| InChIKey | QJELMRAVEXUCJU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|