About 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide
5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide (PubChem CID 136575695) has the molecular formula C18H12BrN5O2
and a molecular weight of 410.23 g/mol. Its IUPAC name is 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide.
Molecular Properties
| Compound Name | 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide |
| PubChem CID | 136575695 |
| Molecular Formula | C18H12BrN5O2 |
| Molecular Weight | 410.23 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide |
| SMILES | O=C(NNc1ncnc2ccccc12)c1cc(-c2ccccc2Br)on1 |
| InChI | InChI=1S/C18H12BrN5O2/c19-13-7-3-1-5-11(13)16-9-15(24-26-16)18(25)23-22-17-12-6-2-4-8-14(12)20-10-21-17/h1-10H,(H,23,25)(H,20,21,22) |
| InChIKey | QVQORBSKVKSDAI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide?
The IUPAC name of 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide (CID 136575695) is 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide.
What is the SMILES notation for 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide?
The canonical SMILES for 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide is O=C(NNc1ncnc2ccccc12)c1cc(-c2ccccc2Br)on1.
What is the InChIKey of 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide?
The InChIKey is QVQORBSKVKSDAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrN5O2/c19-13-7-3-1-5-11(13)16-9-15(24-26-16)18(25)23-22-17-12-6-2-4-8-14(12)20-10-21-17/h1-10H,(H,23,25)(H,20,21,22).
What are the key properties of 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide?
5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide has a molecular weight of 410.23 g/mol, XLogP of 3.80, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromophenyl)-N'-quinazolin-4-yl-1,2-oxazole-3-carbohydrazide is sourced from PubChem (CID 136575695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).