C23H23N5O2 — CID 9118407
(1R,6R)-N-benzyl-6-[(quinazolin-4-ylamino)carbamoyl]cyclohex-3-ene-1-carboxamide (PubChem CID 9118407) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is (1R,6R)-N-benzyl-6-[(quinazolin-4-ylamino)carbamoyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6R)-N-benzyl-6-[(quinazolin-4-ylamino)carbamoyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 9118407 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (1R,6R)-N-benzyl-6-[(quinazolin-4-ylamino)carbamoyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1CC=CC[C@H]1C(=O)NNc1ncnc2ccccc12 |
| InChI | InChI=1S/C23H23N5O2/c29-22(24-14-16-8-2-1-3-9-16)17-10-4-5-11-18(17)23(30)28-27-21-19-12-6-7-13-20(19)25-15-26-21/h1-9,12-13,15,17-18H,10-11,14H2,(H,24,29)(H,28,30)(H,25,26,27)/t17-,18-/m1/s1 |
| InChIKey | ICEUPMXJFYIHGF-QZTJIDSGSA-N |
| XLogP | 2.97 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|