C16H13N5OS — CID 66573988
N-[(quinazolin-4-ylamino)carbamothioyl]benzamide (PubChem CID 66573988) has the molecular formula C16H13N5OS and a molecular weight of 323.38 g/mol. Its IUPAC name is N-[(quinazolin-4-ylamino)carbamothioyl]benzamide.
| Compound Name | N-[(quinazolin-4-ylamino)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 66573988 |
| Molecular Formula | C16H13N5OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-[(quinazolin-4-ylamino)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)NNc1ncnc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C16H13N5OS/c22-15(11-6-2-1-3-7-11)19-16(23)21-20-14-12-8-4-5-9-13(12)17-10-18-14/h1-10H,(H,17,18,20)(H2,19,21,22,23) |
| InChIKey | ZELPJFFQNJKYCL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|