C25H22N4O2 — CID 4649648
3-(1,2-dihydroacenaphthylen-5-yl)-N'-[1-(4-methoxyphenyl)ethenyl]-1H-pyrazole-5-carbohydrazide (PubChem CID 4649648) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-(1,2-dihydroacenaphthylen-5-yl)-N'-[1-(4-methoxyphenyl)ethenyl]-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-(1,2-dihydroacenaphthylen-5-yl)-N'-[1-(4-methoxyphenyl)ethenyl]-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 4649648 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-(1,2-dihydroacenaphthylen-5-yl)-N'-[1-(4-methoxyphenyl)ethenyl]-1H-pyrazole-5-carbohydrazide |
| SMILES | C=C(NNC(=O)c1cc(-c2ccc3c4c(cccc24)CC3)n[nH]1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H22N4O2/c1-15(16-8-11-19(31-2)12-9-16)26-29-25(30)23-14-22(27-28-23)20-13-10-18-7-6-17-4-3-5-21(20)24(17)18/h3-5,8-14,26H,1,6-7H2,2H3,(H,27,28)(H,29,30) |
| InChIKey | QAQHSKJDOYABRU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|