C24H18Cl2N4O — CID 6262458
N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide (PubChem CID 6262458) has the molecular formula C24H18Cl2N4O and a molecular weight of 449.34 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6262458 |
| Molecular Formula | C24H18Cl2N4O |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(-c2ccc3c4c(cccc24)CC3)n[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H18Cl2N4O/c1-13(17-10-8-16(25)11-20(17)26)27-30-24(31)22-12-21(28-29-22)18-9-7-15-6-5-14-3-2-4-19(18)23(14)15/h2-4,7-12H,5-6H2,1H3,(H,28,29)(H,30,31)/b27-13- |
| InChIKey | KETJLSRPJXHMSC-WKIKZPBSSA-N |
| XLogP | 5.79 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|