C23H18N4O — CID 6023521
N-[(Z)-benzylideneamino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide (PubChem CID 6023521) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[(Z)-benzylideneamino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-benzylideneamino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6023521 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[(Z)-benzylideneamino]-3-(1,2-dihydroacenaphthylen-5-yl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C\c1ccccc1)c1cc(-c2ccc3c4c(cccc24)CC3)n[nH]1 |
| InChI | InChI=1S/C23H18N4O/c28-23(27-24-14-15-5-2-1-3-6-15)21-13-20(25-26-21)18-12-11-17-10-9-16-7-4-8-19(18)22(16)17/h1-8,11-14H,9-10H2,(H,25,26)(H,27,28)/b24-14- |
| InChIKey | QUSDQICMFSTWII-OYKKKHCWSA-N |
| XLogP | 4.09 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|