C26H22N4O2 — CID 5098672
3-(1,2-dihydroacenaphthylen-5-yl)-N-[3-(2-methoxyphenyl)prop-2-enylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 5098672) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-(1,2-dihydroacenaphthylen-5-yl)-N-[3-(2-methoxyphenyl)prop-2-enylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(1,2-dihydroacenaphthylen-5-yl)-N-[3-(2-methoxyphenyl)prop-2-enylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5098672 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-(1,2-dihydroacenaphthylen-5-yl)-N-[3-(2-methoxyphenyl)prop-2-enylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccccc1C=CC=NNC(=O)c1cc(-c2ccc3c4c(cccc24)CC3)n[nH]1 |
| InChI | InChI=1S/C26H22N4O2/c1-32-24-10-3-2-6-17(24)8-5-15-27-30-26(31)23-16-22(28-29-23)20-14-13-19-12-11-18-7-4-9-21(20)25(18)19/h2-10,13-16H,11-12H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | GZAIPKLFQCTDGL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|