C24H30N2O9 — CID 17366613
(2,6-dimethoxyphenyl)-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid (PubChem CID 17366613) has the molecular formula C24H30N2O9 and a molecular weight of 490.51 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid.
| Compound Name | (2,6-dimethoxyphenyl)-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 17366613 |
| Molecular Formula | C24H30N2O9 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (2,6-dimethoxyphenyl)-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
| SMILES | COc1ccc(CN2CCN(C(=O)c3c(OC)cccc3OC)CC2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H28N2O5.C2H2O4/c1-26-17-9-8-16(14-20(17)29-4)15-23-10-12-24(13-11-23)22(25)21-18(27-2)6-5-7-19(21)28-3;3-1(4)2(5)6/h5-9,14H,10-13,15H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | QFOMGPNHQJYZLV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|