C24H24ClN3O2 — CID 36998498
[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[4-(pyridin-4-ylmethoxy)phenyl]methanone (PubChem CID 36998498) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[4-(pyridin-4-ylmethoxy)phenyl]methanone.
| Compound Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[4-(pyridin-4-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 36998498 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-[4-(pyridin-4-ylmethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCc2ccncc2)cc1)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H24ClN3O2/c25-22-3-1-2-20(16-22)17-27-12-14-28(15-13-27)24(29)21-4-6-23(7-5-21)30-18-19-8-10-26-11-9-19/h1-11,16H,12-15,17-18H2 |
| InChIKey | XUHHHKOYMDRXIB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |