C21H22N2OS — CID 24549487
(5-methylthiophen-2-yl)-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone (PubChem CID 24549487) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is (5-methylthiophen-2-yl)-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (5-methylthiophen-2-yl)-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24549487 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (5-methylthiophen-2-yl)-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(Cc3cccc4ccccc34)CC2)s1 |
| InChI | InChI=1S/C21H22N2OS/c1-16-9-10-20(25-16)21(24)23-13-11-22(12-14-23)15-18-7-4-6-17-5-2-3-8-19(17)18/h2-10H,11-15H2,1H3 |
| InChIKey | PYFWNYAQWIFUIF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |