C12H17N3O3S2 — CID 118767416
[1-(2-methylsulfanylpyridine-3-carbonyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 118767416) has the molecular formula C12H17N3O3S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is [1-(2-methylsulfanylpyridine-3-carbonyl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(2-methylsulfanylpyridine-3-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 118767416 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [1-(2-methylsulfanylpyridine-3-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | CSc1ncccc1C(=O)N1CCC(CS(N)(=O)=O)C1 |
| InChI | InChI=1S/C12H17N3O3S2/c1-19-11-10(3-2-5-14-11)12(16)15-6-4-9(7-15)8-20(13,17)18/h2-3,5,9H,4,6-8H2,1H3,(H2,13,17,18) |
| InChIKey | GMOJTMSNIBNMOW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |