C12H16N2O3S2 — CID 97414904
(2-methylsulfanyl-3-pyridinyl)-[(3R)-3-methylsulfonylpyrrolidin-1-yl]methanone (PubChem CID 97414904) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2-methylsulfanyl-3-pyridinyl)-[(3R)-3-methylsulfonylpyrrolidin-1-yl]methanone.
| Compound Name | (2-methylsulfanyl-3-pyridinyl)-[(3R)-3-methylsulfonylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 97414904 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (2-methylsulfanyl-3-pyridinyl)-[(3R)-3-methylsulfonylpyrrolidin-1-yl]methanone |
| SMILES | CSc1ncccc1C(=O)N1CC[C@@H](S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-18-11-10(4-3-6-13-11)12(15)14-7-5-9(8-14)19(2,16)17/h3-4,6,9H,5,7-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | FPUNJEUIVFOPFI-SECBINFHSA-N |
| XLogP | 1.06 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |