C24H35FIN5O2 — CID 111762816
1-[(3,4-dimethoxyphenyl)methyl]-3-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111762816) has the molecular formula C24H35FIN5O2 and a molecular weight of 571.48 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111762816 |
| Molecular Formula | C24H35FIN5O2 |
| Molecular Weight | 571.48 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN1CCN(c2ccc(CN/C(=N/C)NCc3ccc(OC)c(OC)c3)cc2F)CC1.I |
| InChI | InChI=1S/C24H34FN5O2.HI/c1-5-29-10-12-30(13-11-29)21-8-6-18(14-20(21)25)16-27-24(26-2)28-17-19-7-9-22(31-3)23(15-19)32-4;/h6-9,14-15H,5,10-13,16-17H2,1-4H3,(H2,26,27,28);1H |
| InChIKey | RZBUUPNYSSEHRG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|