C22H37IN6O2 — CID 111765844
ethyl 4-[[N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111765844) has the molecular formula C22H37IN6O2 and a molecular weight of 544.48 g/mol. Its IUPAC name is ethyl 4-[[N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111765844 |
| Molecular Formula | C22H37IN6O2 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | ethyl 4-[[N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCc2ccnc(N3CCCCCC3)c2)CC1.I |
| InChI | InChI=1S/C22H36N6O2.HI/c1-3-30-22(29)28-14-9-19(10-15-28)26-21(23-2)25-17-18-8-11-24-20(16-18)27-12-6-4-5-7-13-27;/h8,11,16,19H,3-7,9-10,12-15,17H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | RZCDFNQXTITRJU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|