C22H36N6O2 — CID 111328872
ethyl 4-[[N-ethyl-N'-[(2-piperidin-1-yl-4-pyridinyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328872) has the molecular formula C22H36N6O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[(2-piperidin-1-yl-4-pyridinyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[(2-piperidin-1-yl-4-pyridinyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328872 |
| Molecular Formula | C22H36N6O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[(2-piperidin-1-yl-4-pyridinyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCCCC2)c1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C22H36N6O2/c1-3-23-21(26-19-9-14-28(15-10-19)22(29)30-4-2)25-17-18-8-11-24-20(16-18)27-12-6-5-7-13-27/h8,11,16,19H,3-7,9-10,12-15,17H2,1-2H3,(H2,23,25,26) |
| InChIKey | ZGJCDHJCDGOGIU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|