C25H40N6O — CID 111995975
3-[[N'-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]-N-cyclopropylcyclohexane-1-carboxamide (PubChem CID 111995975) has the molecular formula C25H40N6O and a molecular weight of 440.64 g/mol. Its IUPAC name is 3-[[N'-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]-N-cyclopropylcyclohexane-1-carboxamide.
| Compound Name | 3-[[N'-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]-N-cyclopropylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 111995975 |
| Molecular Formula | C25H40N6O |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 3-[[N'-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]-N-cyclopropylcyclohexane-1-carboxamide |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCCCCC2)c1)NC1CCCC(C(=O)NC2CC2)C1 |
| InChI | InChI=1S/C25H40N6O/c1-2-26-25(30-22-9-7-8-20(17-22)24(32)29-21-10-11-21)28-18-19-12-13-27-23(16-19)31-14-5-3-4-6-15-31/h12-13,16,20-22H,2-11,14-15,17-18H2,1H3,(H,29,32)(H2,26,28,30) |
| InChIKey | OSWAWBCRUAVPNV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|