C22H25ClN6 — CID 109462860
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(2-pyrazol-1-ylphenyl)methyl]guanidine (PubChem CID 109462860) has the molecular formula C22H25ClN6 and a molecular weight of 408.94 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(2-pyrazol-1-ylphenyl)methyl]guanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(2-pyrazol-1-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 109462860 |
| Molecular Formula | C22H25ClN6 |
| Molecular Weight | 408.94 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[(2-pyrazol-1-ylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1-n1cccn1)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C22H25ClN6/c1-24-22(25-15-17-6-2-3-9-21(17)29-12-5-11-26-29)27-19-10-13-28(16-19)20-8-4-7-18(23)14-20/h2-9,11-12,14,19H,10,13,15-16H2,1H3,(H2,24,25,27) |
| InChIKey | ZSHISZBESQIYGN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.94 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|