C20H29N5O — CID 111959155
N-[(1-benzylpyrazol-4-yl)methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide (PubChem CID 111959155) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is N-[(1-benzylpyrazol-4-yl)methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide.
| Compound Name | N-[(1-benzylpyrazol-4-yl)methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959155 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | N-[(1-benzylpyrazol-4-yl)methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N/C)NCc2cnn(Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C20H29N5O/c1-3-26-19-9-11-24(12-10-19)20(21-2)22-13-18-14-23-25(16-18)15-17-7-5-4-6-8-17/h4-8,14,16,19H,3,9-13,15H2,1-2H3,(H,21,22) |
| InChIKey | XKTNFIDGBYPWHT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|