C17H31IN4O3S — CID 111665241
1-ethyl-2-[3-(ethylsulfonylamino)propyl]-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111665241) has the molecular formula C17H31IN4O3S and a molecular weight of 498.43 g/mol. Its IUPAC name is 1-ethyl-2-[3-(ethylsulfonylamino)propyl]-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(ethylsulfonylamino)propyl]-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111665241 |
| Molecular Formula | C17H31IN4O3S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-ethyl-2-[3-(ethylsulfonylamino)propyl]-3-(3-hydroxy-3-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCNS(=O)(=O)CC)NCCC(O)c1ccccc1.I |
| InChI | InChI=1S/C17H30N4O3S.HI/c1-3-18-17(19-12-8-13-21-25(23,24)4-2)20-14-11-16(22)15-9-6-5-7-10-15;/h5-7,9-10,16,21-22H,3-4,8,11-14H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | PVWOITUNMPJYKR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|