C23H34N4O — CID 111665076
1-ethyl-3-(3-hydroxy-3-phenylpropyl)-2-[4-(N-methylanilino)butyl]guanidine (PubChem CID 111665076) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-ethyl-3-(3-hydroxy-3-phenylpropyl)-2-[4-(N-methylanilino)butyl]guanidine.
| Compound Name | 1-ethyl-3-(3-hydroxy-3-phenylpropyl)-2-[4-(N-methylanilino)butyl]guanidine |
|---|---|
| PubChem CID | 111665076 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 1-ethyl-3-(3-hydroxy-3-phenylpropyl)-2-[4-(N-methylanilino)butyl]guanidine |
| SMILES | CCN/C(=N\CCCCN(C)c1ccccc1)NCCC(O)c1ccccc1 |
| InChI | InChI=1S/C23H34N4O/c1-3-24-23(26-18-16-22(28)20-12-6-4-7-13-20)25-17-10-11-19-27(2)21-14-8-5-9-15-21/h4-9,12-15,22,28H,3,10-11,16-19H2,1-2H3,(H2,24,25,26) |
| InChIKey | FNKVMEHFLAHFFI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|