C14H24F3N5 — CID 109473233
1-ethyl-2-[4-(2-methylimidazol-1-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473233) has the molecular formula C14H24F3N5 and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-ethyl-2-[4-(2-methylimidazol-1-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[4-(2-methylimidazol-1-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473233 |
| Molecular Formula | C14H24F3N5 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 1-ethyl-2-[4-(2-methylimidazol-1-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCCCn1ccnc1C)NCCC(F)(F)F |
| InChI | InChI=1S/C14H24F3N5/c1-3-18-13(21-8-6-14(15,16)17)20-7-4-5-10-22-11-9-19-12(22)2/h9,11H,3-8,10H2,1-2H3,(H2,18,20,21) |
| InChIKey | BGWVSTRWCNHSOH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|