C11H26N4O3S — CID 106339646
N'-hydroxy-5-[3-(methanesulfonamido)propylamino]-2,2-dimethylpentanimidamide (PubChem CID 106339646) has the molecular formula C11H26N4O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is N'-hydroxy-5-[3-(methanesulfonamido)propylamino]-2,2-dimethylpentanimidamide.
| Compound Name | N'-hydroxy-5-[3-(methanesulfonamido)propylamino]-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 106339646 |
| Molecular Formula | C11H26N4O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N'-hydroxy-5-[3-(methanesulfonamido)propylamino]-2,2-dimethylpentanimidamide |
| SMILES | CC(C)(CCCNCCCNS(C)(=O)=O)C(N)=NO |
| InChI | InChI=1S/C11H26N4O3S/c1-11(2,10(12)15-16)6-4-7-13-8-5-9-14-19(3,17)18/h13-14,16H,4-9H2,1-3H3,(H2,12,15) |
| InChIKey | XAFJRRVPSZNOGJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|