C7H8BrF7 — CID 87921894
1-bromo-1,1,2,2,6,6,6-heptafluoro-5-methylhexane (PubChem CID 87921894) has the molecular formula C7H8BrF7 and a molecular weight of 305.03 g/mol. Its IUPAC name is 1-bromo-1,1,2,2,6,6,6-heptafluoro-5-methylhexane.
| Compound Name | 1-bromo-1,1,2,2,6,6,6-heptafluoro-5-methylhexane |
|---|---|
| PubChem CID | 87921894 |
| Molecular Formula | C7H8BrF7 |
| Molecular Weight | 305.03 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 1-bromo-1,1,2,2,6,6,6-heptafluoro-5-methylhexane |
| SMILES | CC(CCC(F)(F)C(F)(F)Br)C(F)(F)F |
| InChI | InChI=1S/C7H8BrF7/c1-4(6(11,12)13)2-3-5(9,10)7(8,14)15/h4H,2-3H2,1H3 |
| InChIKey | XFOJVWYWTWFMQI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.03 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|