C18H23F7O2 — CID 162347168
8,8,9,9,10,10,10-heptafluoro-6-(2-phenylethyl)decane-1,6-diol (PubChem CID 162347168) has the molecular formula C18H23F7O2 and a molecular weight of 404.37 g/mol. Its IUPAC name is 8,8,9,9,10,10,10-heptafluoro-6-(2-phenylethyl)decane-1,6-diol.
| Compound Name | 8,8,9,9,10,10,10-heptafluoro-6-(2-phenylethyl)decane-1,6-diol |
|---|---|
| PubChem CID | 162347168 |
| Molecular Formula | C18H23F7O2 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 8,8,9,9,10,10,10-heptafluoro-6-(2-phenylethyl)decane-1,6-diol |
| SMILES | OCCCCCC(O)(CCc1ccccc1)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H23F7O2/c19-16(20,17(21,22)18(23,24)25)13-15(27,10-5-2-6-12-26)11-9-14-7-3-1-4-8-14/h1,3-4,7-8,26-27H,2,5-6,9-13H2 |
| InChIKey | OJNBSONWPKAQLU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|