C15H20F4O2 — CID 86658311
4,4,5,5-tetrafluoro-6-(3-phenylpropoxy)hexan-1-ol (PubChem CID 86658311) has the molecular formula C15H20F4O2 and a molecular weight of 308.31 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-6-(3-phenylpropoxy)hexan-1-ol.
| Compound Name | 4,4,5,5-tetrafluoro-6-(3-phenylpropoxy)hexan-1-ol |
|---|---|
| PubChem CID | 86658311 |
| Molecular Formula | C15H20F4O2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4,4,5,5-tetrafluoro-6-(3-phenylpropoxy)hexan-1-ol |
| SMILES | OCCCC(F)(F)C(F)(F)COCCCc1ccccc1 |
| InChI | InChI=1S/C15H20F4O2/c16-14(17,9-5-10-20)15(18,19)12-21-11-4-8-13-6-2-1-3-7-13/h1-3,6-7,20H,4-5,8-12H2 |
| InChIKey | XVJLTGUEXPFCPO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|