C15H14F13NO2S — CID 54514910
2-(propanethioylamino)ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methylidenenonanoate (PubChem CID 54514910) has the molecular formula C15H14F13NO2S and a molecular weight of 519.32 g/mol. Its IUPAC name is 2-(propanethioylamino)ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methylidenenonanoate.
| Compound Name | 2-(propanethioylamino)ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methylidenenonanoate |
|---|---|
| PubChem CID | 54514910 |
| Molecular Formula | C15H14F13NO2S |
| Molecular Weight | 519.32 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 2-(propanethioylamino)ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methylidenenonanoate |
| SMILES | C=C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCNC(=S)CC |
| InChI | InChI=1S/C15H14F13NO2S/c1-3-8(32)29-4-5-31-9(30)7(2)6-10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h2-6H2,1H3,(H,29,32) |
| InChIKey | YLSZWAZOESKASS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|