C19H34F6O7Si4-2 — CID 154150838
2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-[3-tris(trimethylsilyloxy)silylpropyl]but-2-enedioate (PubChem CID 154150838) has the molecular formula C19H34F6O7Si4-2 and a molecular weight of 600.81 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-[3-tris(trimethylsilyloxy)silylpropyl]but-2-enedioate.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-[3-tris(trimethylsilyloxy)silylpropyl]but-2-enedioate |
|---|---|
| PubChem CID | 154150838 |
| Molecular Formula | C19H34F6O7Si4-2 |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-[3-tris(trimethylsilyloxy)silylpropyl]but-2-enedioate |
| SMILES | C[Si](C)(C)O[Si](CCCC(C(=O)[O-])=C(C(=O)[O-])C(C(F)(F)F)C(F)(F)F)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H36F6O7Si4/c1-33(2,3)30-36(31-34(4,5)6,32-35(7,8)9)12-10-11-13(16(26)27)14(17(28)29)15(18(20,21)22)19(23,24)25/h15H,10-12H2,1-9H3,(H,26,27)(H,28,29)/p-2 |
| InChIKey | JLYNFXULFBDTMA-UHFFFAOYSA-L |
| XLogP | 3.80 |
| TPSA | 107.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|